C14H19NO3S — CID 141072530
2-octoxythieno[2,3-d][1,3]oxazin-4-one (PubChem CID 141072530) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is 2-octoxythieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-octoxythieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 141072530 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 2-octoxythieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCCCCOc1nc2sccc2c(=O)o1 |
| InChI | InChI=1S/C14H19NO3S/c1-2-3-4-5-6-7-9-17-14-15-12-11(8-10-19-12)13(16)18-14/h8,10H,2-7,9H2,1H3 |
| InChIKey | HFRLVFZJCREUHH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|