C9H9NO2S — CID 130651588
2-propylthieno[2,3-d][1,3]oxazin-4-one (PubChem CID 130651588) has the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-propylthieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-propylthieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 130651588 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-propylthieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCc1nc2sccc2c(=O)o1 |
| InChI | InChI=1S/C9H9NO2S/c1-2-3-7-10-8-6(4-5-13-8)9(11)12-7/h4-5H,2-3H2,1H3 |
| InChIKey | YRCQQILPAIGELZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |