About 2-propylthieno[2,3-d][1,3]oxazin-4-one
2-propylthieno[2,3-d][1,3]oxazin-4-one (PubChem CID 130651588) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-propylthieno[2,3-d][1,3]oxazin-4-one.
Molecular Properties
| Compound Name | 2-propylthieno[2,3-d][1,3]oxazin-4-one |
| PubChem CID | 130651588 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 2-propylthieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCc1nc2sccc2c(=O)o1 |
| InChI | InChI=1S/C9H9NO2S/c1-2-3-7-10-8-6(4-5-13-8)9(11)12-7/h4-5H,2-3H2,1H3 |
| InChIKey | YRCQQILPAIGELZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-propylthieno[2,3-d][1,3]oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylthieno[2,3-d][1,3]oxazin-4-one?
The IUPAC name of 2-propylthieno[2,3-d][1,3]oxazin-4-one (CID 130651588) is 2-propylthieno[2,3-d][1,3]oxazin-4-one.
What is the SMILES notation for 2-propylthieno[2,3-d][1,3]oxazin-4-one?
The canonical SMILES for 2-propylthieno[2,3-d][1,3]oxazin-4-one is CCCc1nc2sccc2c(=O)o1.
What is the InChIKey of 2-propylthieno[2,3-d][1,3]oxazin-4-one?
The InChIKey is YRCQQILPAIGELZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-2-3-7-10-8-6(4-5-13-8)9(11)12-7/h4-5H,2-3H2,1H3.
What are the key properties of 2-propylthieno[2,3-d][1,3]oxazin-4-one?
2-propylthieno[2,3-d][1,3]oxazin-4-one has a molecular weight of 195.24 g/mol, XLogP of 2.20, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylthieno[2,3-d][1,3]oxazin-4-one is sourced from PubChem (CID 130651588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).