C12H9NO2S2 — CID 744713
2-ethyl-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-4-one (PubChem CID 744713) has the molecular formula C12H9NO2S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is 2-ethyl-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-ethyl-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 744713 |
| Molecular Formula | C12H9NO2S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-ethyl-5-thiophen-2-ylthieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCc1nc2scc(-c3cccs3)c2c(=O)o1 |
| InChI | InChI=1S/C12H9NO2S2/c1-2-9-13-11-10(12(14)15-9)7(6-17-11)8-4-3-5-16-8/h3-6H,2H2,1H3 |
| InChIKey | RYECSJPTPDCARF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |