C16H18N2O3S4 — CID 86887711
3-ethyl-2-(3-methylsulfonylpropylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one (PubChem CID 86887711) has the molecular formula C16H18N2O3S4 and a molecular weight of 414.60 g/mol. Its IUPAC name is 3-ethyl-2-(3-methylsulfonylpropylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-2-(3-methylsulfonylpropylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 86887711 |
| Molecular Formula | C16H18N2O3S4 |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | 3-ethyl-2-(3-methylsulfonylpropylsulfanyl)-5-thiophen-2-ylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCn1c(SCCCS(C)(=O)=O)nc2scc(-c3cccs3)c2c1=O |
| InChI | InChI=1S/C16H18N2O3S4/c1-3-18-15(19)13-11(12-6-4-7-22-12)10-24-14(13)17-16(18)23-8-5-9-25(2,20)21/h4,6-7,10H,3,5,8-9H2,1-2H3 |
| InChIKey | CDGQNYUJDGEIMC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 69.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|