C23H37NO4S — CID 10173366
6-(6-methoxy-6-methylheptan-2-yl)-2-octoxythieno[2,3-d][1,3]oxazin-4-one (PubChem CID 10173366) has the molecular formula C23H37NO4S and a molecular weight of 423.62 g/mol. Its IUPAC name is 6-(6-methoxy-6-methylheptan-2-yl)-2-octoxythieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 6-(6-methoxy-6-methylheptan-2-yl)-2-octoxythieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 10173366 |
| Molecular Formula | C23H37NO4S |
| Molecular Weight | 423.62 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | 6-(6-methoxy-6-methylheptan-2-yl)-2-octoxythieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCCCCOc1nc2sc(C(C)CCCC(C)(C)OC)cc2c(=O)o1 |
| InChI | InChI=1S/C23H37NO4S/c1-6-7-8-9-10-11-15-27-22-24-20-18(21(25)28-22)16-19(29-20)17(2)13-12-14-23(3,4)26-5/h16-17H,6-15H2,1-5H3 |
| InChIKey | HTEGYYZKQGEHCK-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.62 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|