C21H33NO3S — CID 10215866
6-heptyl-2-octan-2-yloxythieno[2,3-d][1,3]oxazin-4-one (PubChem CID 10215866) has the molecular formula C21H33NO3S and a molecular weight of 379.57 g/mol. Its IUPAC name is 6-heptyl-2-octan-2-yloxythieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 6-heptyl-2-octan-2-yloxythieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 10215866 |
| Molecular Formula | C21H33NO3S |
| Molecular Weight | 379.57 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 6-heptyl-2-octan-2-yloxythieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCCCc1cc2c(=O)oc(OC(C)CCCCCC)nc2s1 |
| InChI | InChI=1S/C21H33NO3S/c1-4-6-8-10-12-14-17-15-18-19(26-17)22-21(25-20(18)23)24-16(3)13-11-9-7-5-2/h15-16H,4-14H2,1-3H3 |
| InChIKey | AHJXEVAYIVUFDZ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|