C13H16N2Na2O4S — CID 90672964
disodium;6-hexyl-4-oxidothieno[2,3-d]pyrimidine-2-carboxylate;hydrate (PubChem CID 90672964) has the molecular formula C13H16N2Na2O4S and a molecular weight of 342.33 g/mol. Its IUPAC name is disodium;6-hexyl-4-oxidothieno[2,3-d]pyrimidine-2-carboxylate;hydrate.
| Compound Name | disodium;6-hexyl-4-oxidothieno[2,3-d]pyrimidine-2-carboxylate;hydrate |
|---|---|
| PubChem CID | 90672964 |
| Molecular Formula | C13H16N2Na2O4S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.06 |
| IUPAC Name | disodium;6-hexyl-4-oxidothieno[2,3-d]pyrimidine-2-carboxylate;hydrate |
| SMILES | CCCCCCc1cc2c([O-])nc(C(=O)[O-])nc2s1.O.[Na+].[Na+] |
| InChI | InChI=1S/C13H16N2O3S.2Na.H2O/c1-2-3-4-5-6-8-7-9-11(16)14-10(13(17)18)15-12(9)19-8;;;/h7H,2-6H2,1H3,(H,17,18)(H,14,15,16);;;1H2/q;2*+1;/p-2 |
| InChIKey | JOHBAVIJPHBAEC-UHFFFAOYSA-L |
| XLogP | -5.57 |
| TPSA | 120.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | -5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|