C18H20N2O3S — CID 69026444
2-(4-methoxyanilino)-6-pentylthieno[2,3-d][1,3]oxazin-4-one (PubChem CID 69026444) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is 2-(4-methoxyanilino)-6-pentylthieno[2,3-d][1,3]oxazin-4-one.
| Compound Name | 2-(4-methoxyanilino)-6-pentylthieno[2,3-d][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 69026444 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-(4-methoxyanilino)-6-pentylthieno[2,3-d][1,3]oxazin-4-one |
| SMILES | CCCCCc1cc2c(=O)oc(Nc3ccc(OC)cc3)nc2s1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-4-5-6-14-11-15-16(24-14)20-18(23-17(15)21)19-12-7-9-13(22-2)10-8-12/h7-11H,3-6H2,1-2H3,(H,19,20) |
| InChIKey | HIXVJDGSCAKXLY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|