C23H36O3S2 — CID 102163026
decyl 5-hexoxythieno[3,2-b]thiophene-2-carboxylate (PubChem CID 102163026) has the molecular formula C23H36O3S2 and a molecular weight of 424.67 g/mol. Its IUPAC name is decyl 5-hexoxythieno[3,2-b]thiophene-2-carboxylate.
| Compound Name | decyl 5-hexoxythieno[3,2-b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 102163026 |
| Molecular Formula | C23H36O3S2 |
| Molecular Weight | 424.67 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | decyl 5-hexoxythieno[3,2-b]thiophene-2-carboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1cc2sc(OCCCCCC)cc2s1 |
| InChI | InChI=1S/C23H36O3S2/c1-3-5-7-9-10-11-12-14-16-26-23(24)21-17-19-20(27-21)18-22(28-19)25-15-13-8-6-4-2/h17-18H,3-16H2,1-2H3 |
| InChIKey | SZZVJZSVKMVUDM-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.67 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|