C43H60O4S4 — CID 70957869
octyl 6-methyl-4-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[2,3-c]thiophene-2-carboxylate (PubChem CID 70957869) has the molecular formula C43H60O4S4 and a molecular weight of 769.22 g/mol. Its IUPAC name is octyl 6-methyl-4-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[2,3-c]thiophene-2-carboxylate.
| Compound Name | octyl 6-methyl-4-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[2,3-c]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 70957869 |
| Molecular Formula | C43H60O4S4 |
| Molecular Weight | 769.22 g/mol |
| Exact Mass | 768.34 |
| IUPAC Name | octyl 6-methyl-4-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[2,3-c]thiophene-2-carboxylate |
| SMILES | CCCCCCCCOC(=O)c1cc2c(-c3cc4c(OCCCCCCCC)c5sc(C)cc5c(OCCCCCCCC)c4s3)sc(C)c2s1 |
| InChI | InChI=1S/C43H60O4S4/c1-6-9-12-15-18-21-24-45-37-32-27-30(4)48-41(32)38(46-25-22-19-16-13-10-7-2)33-28-35(50-42(33)37)40-34-29-36(51-39(34)31(5)49-40)43(44)47-26-23-20-17-14-11-8-3/h27-29H,6-26H2,1-5H3 |
| InChIKey | XIJRBVOLWFDNRS-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.22 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|