C41H48O3S4 — CID 58568484
[4-methyl-6-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[3,4-b]thiophen-2-yl]-phenylmethanone (PubChem CID 58568484) has the molecular formula C41H48O3S4 and a molecular weight of 717.10 g/mol. Its IUPAC name is [4-methyl-6-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[3,4-b]thiophen-2-yl]-phenylmethanone.
| Compound Name | [4-methyl-6-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[3,4-b]thiophen-2-yl]-phenylmethanone |
|---|---|
| PubChem CID | 58568484 |
| Molecular Formula | C41H48O3S4 |
| Molecular Weight | 717.10 g/mol |
| Exact Mass | 716.25 |
| IUPAC Name | [4-methyl-6-(6-methyl-4,8-dioctoxythieno[2,3-f][1]benzothiol-2-yl)thieno[3,4-b]thiophen-2-yl]-phenylmethanone |
| SMILES | CCCCCCCCOc1c2cc(-c3sc(C)c4cc(C(=O)c5ccccc5)sc34)sc2c(OCCCCCCCC)c2cc(C)sc12 |
| InChI | InChI=1S/C41H48O3S4/c1-5-7-9-11-13-18-22-43-36-31-24-27(3)45-38(31)37(44-23-19-14-12-10-8-6-2)32-26-34(48-39(32)36)41-40-30(28(4)46-41)25-33(47-40)35(42)29-20-16-15-17-21-29/h15-17,20-21,24-26H,5-14,18-19,22-23H2,1-4H3 |
| InChIKey | QGWABRYNAJILBQ-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.10 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|