C38H40O3S4 — CID 58568475
2,12-diethoxy-7-methyl-17-(4-methyl-2-octoxythieno[3,4-b]thiophen-6-yl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene (PubChem CID 58568475) has the molecular formula C38H40O3S4 and a molecular weight of 673.00 g/mol. Its IUPAC name is 2,12-diethoxy-7-methyl-17-(4-methyl-2-octoxythieno[3,4-b]thiophen-6-yl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene.
| Compound Name | 2,12-diethoxy-7-methyl-17-(4-methyl-2-octoxythieno[3,4-b]thiophen-6-yl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene |
|---|---|
| PubChem CID | 58568475 |
| Molecular Formula | C38H40O3S4 |
| Molecular Weight | 673.00 g/mol |
| Exact Mass | 672.19 |
| IUPAC Name | 2,12-diethoxy-7-methyl-17-(4-methyl-2-octoxythieno[3,4-b]thiophen-6-yl)-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1,3(11),4,7,9,12,14,17,19-nonaene |
| SMILES | CCCCCCCCOc1cc2c(C)sc(-c3cc4cc5c(OCC)c6cc7sc(C)cc7cc6c(OCC)c5cc4s3)c2s1 |
| InChI | InChI=1S/C38H40O3S4/c1-6-9-10-11-12-13-14-41-34-21-26-23(5)43-38(37(26)45-34)33-18-25-17-28-30(20-32(25)44-33)35(39-7-2)27-16-24-15-22(4)42-31(24)19-29(27)36(28)40-8-3/h15-21H,6-14H2,1-5H3 |
| InChIKey | DUKFYMMUOSXRSB-UHFFFAOYSA-N |
| XLogP | 13.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.00 |
| LogP ≤ 5 | 13.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|