C44H51FO3S4 — CID 89136949
7-(2-ethoxy-3-fluoro-6-methylthieno[2,3-c]thiophen-4-yl)-17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene (PubChem CID 89136949) has the molecular formula C44H51FO3S4 and a molecular weight of 775.15 g/mol. Its IUPAC name is 7-(2-ethoxy-3-fluoro-6-methylthieno[2,3-c]thiophen-4-yl)-17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene.
| Compound Name | 7-(2-ethoxy-3-fluoro-6-methylthieno[2,3-c]thiophen-4-yl)-17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene |
|---|---|
| PubChem CID | 89136949 |
| Molecular Formula | C44H51FO3S4 |
| Molecular Weight | 775.15 g/mol |
| Exact Mass | 774.27 |
| IUPAC Name | 7-(2-ethoxy-3-fluoro-6-methylthieno[2,3-c]thiophen-4-yl)-17-methyl-2,12-dioctoxy-6,16-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,17,19-nonaene |
| SMILES | CCCCCCCCOc1c2cc3cc(-c4sc(C)c5sc(OCC)c(F)c45)sc3cc2c(OCCCCCCCC)c2cc3cc(C)sc3cc12 |
| InChI | InChI=1S/C44H51FO3S4/c1-6-9-11-13-15-17-19-47-40-31-22-29-21-27(4)49-35(29)25-33(31)41(48-20-18-16-14-12-10-7-2)32-23-30-24-37(51-36(30)26-34(32)40)43-38-39(45)44(46-8-3)52-42(38)28(5)50-43/h21-26H,6-20H2,1-5H3 |
| InChIKey | TWMFNKRLRFQXCT-UHFFFAOYSA-N |
| XLogP | 16.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.15 |
| LogP ≤ 5 | 16.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|