C19H29NO4Si — CID 101270664
cis-methyl (1R,2R)-1-acetamido-2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclopropane-1-carboxylate (PubChem CID 101270664) has the molecular formula C19H29NO4Si and a molecular weight of 363.53 g/mol. Its IUPAC name is cis-methyl (1R,2R)-1-acetamido-2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-1-acetamido-2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 101270664 |
| Molecular Formula | C19H29NO4Si |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | cis-methyl (1R,2R)-1-acetamido-2-[3-[tert-butyl(dimethyl)silyl]oxyphenyl]cyclopropane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(NC(C)=O)C[C@@H]1c1cccc(O[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NO4Si/c1-13(21)20-19(17(22)23-5)12-16(19)14-9-8-10-15(11-14)24-25(6,7)18(2,3)4/h8-11,16H,12H2,1-7H3,(H,20,21)/t16-,19-/m1/s1 |
| InChIKey | IGXYTZZCVNMVKE-VQIMIIECSA-N |
| XLogP | 3.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|