C16H23F2NOSi — CID 101271042
N-(2,2-difluoro-1-trimethylsilylethenyl)-4-methoxy-N-(2-methylprop-2-enyl)aniline (PubChem CID 101271042) has the molecular formula C16H23F2NOSi and a molecular weight of 311.45 g/mol. Its IUPAC name is N-(2,2-difluoro-1-trimethylsilylethenyl)-4-methoxy-N-(2-methylprop-2-enyl)aniline.
| Compound Name | N-(2,2-difluoro-1-trimethylsilylethenyl)-4-methoxy-N-(2-methylprop-2-enyl)aniline |
|---|---|
| PubChem CID | 101271042 |
| Molecular Formula | C16H23F2NOSi |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-(2,2-difluoro-1-trimethylsilylethenyl)-4-methoxy-N-(2-methylprop-2-enyl)aniline |
| SMILES | C=C(C)CN(C(=C(F)F)[Si](C)(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H23F2NOSi/c1-12(2)11-19(16(15(17)18)21(4,5)6)13-7-9-14(20-3)10-8-13/h7-10H,1,11H2,2-6H3 |
| InChIKey | XHRVTWLBNXPNCH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|