C11H21BrIN2+ — CID 101271398
bromo-[4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-2-yl]iodanium (PubChem CID 101271398) has the molecular formula C11H21BrIN2+ and a molecular weight of 388.11 g/mol. Its IUPAC name is bromo-[4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-2-yl]iodanium.
| Compound Name | bromo-[4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-2-yl]iodanium |
|---|---|
| PubChem CID | 101271398 |
| Molecular Formula | C11H21BrIN2+ |
| Molecular Weight | 388.11 g/mol |
| Exact Mass | 386.99 |
| IUPAC Name | bromo-[4,5-dimethyl-1,3-di(propan-2-yl)-2H-imidazol-2-yl]iodanium |
| SMILES | CC1=C(C)N(C(C)C)C([I+]Br)N1C(C)C |
| InChI | InChI=1S/C11H21BrIN2/c1-7(2)14-9(5)10(6)15(8(3)4)11(14)13-12/h7-8,11H,1-6H3/q+1 |
| InChIKey | QZVAKBTZMLJGTG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|