About 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole
2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole (PubChem CID 138670254) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole.
Analyze 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole?
The IUPAC name of 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole (CID 138670254) is 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole.
What is the SMILES notation for 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole?
The canonical SMILES for 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole is CC1=NCC(C)N1C(C)C.
What is the InChIKey of 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole?
The InChIKey is PMXWIAVLPFFQLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-6(2)10-7(3)5-9-8(10)4/h6-7H,5H2,1-4H3.
What are the key properties of 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole?
2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole has a molecular weight of 140.23 g/mol, XLogP of 1.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-1-propan-2-yl-4,5-dihydroimidazole is sourced from PubChem (CID 138670254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).