C16H30O3Si — CID 101272506
but-3-en-2-yl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-enoate (PubChem CID 101272506) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is but-3-en-2-yl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-enoate.
| Compound Name | but-3-en-2-yl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 101272506 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | but-3-en-2-yl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-methylpent-4-enoate |
| SMILES | C=CC(C)OC(=O)[C@@H](C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H30O3Si/c1-10-12(3)18-15(17)13(4)14(11-2)19-20(8,9)16(5,6)7/h10-14H,1-2H2,3-9H3/t12?,13-,14+/m0/s1 |
| InChIKey | DTQGGPGZNOUDNU-KFTPUPIBSA-N |
| XLogP | 4.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|