C31H30O8 — CID 101273420
(E)-1-(9-acetyl-1,3,8,10-tetrahydroxy-2,6,6,11-tetramethyl-7,12a-dihydro-6aH-chromeno[3,2-c]chromen-4-yl)-3-phenylprop-2-en-1-one (PubChem CID 101273420) has the molecular formula C31H30O8 and a molecular weight of 530.57 g/mol. Its IUPAC name is (E)-1-(9-acetyl-1,3,8,10-tetrahydroxy-2,6,6,11-tetramethyl-7,12a-dihydro-6aH-chromeno[3,2-c]chromen-4-yl)-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-(9-acetyl-1,3,8,10-tetrahydroxy-2,6,6,11-tetramethyl-7,12a-dihydro-6aH-chromeno[3,2-c]chromen-4-yl)-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 101273420 |
| Molecular Formula | C31H30O8 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | (E)-1-(9-acetyl-1,3,8,10-tetrahydroxy-2,6,6,11-tetramethyl-7,12a-dihydro-6aH-chromeno[3,2-c]chromen-4-yl)-3-phenylprop-2-en-1-one |
| SMILES | CC(=O)c1c(O)c(C)c2c(c1O)CC1C(O2)c2c(O)c(C)c(O)c(C(=O)/C=C/c3ccccc3)c2OC1(C)C |
| InChI | InChI=1S/C31H30O8/c1-14-24(34)22(20(33)12-11-17-9-7-6-8-10-17)30-23(25(14)35)29-19(31(4,5)39-30)13-18-27(37)21(16(3)32)26(36)15(2)28(18)38-29/h6-12,19,29,34-37H,13H2,1-5H3/b12-11+ |
| InChIKey | MVVFHQOKTKNFCX-VAWYXSNFSA-N |
| XLogP | 5.69 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|