C26H28O4 — CID 102294975
(E)-1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]-3-phenylprop-2-en-1-one (PubChem CID 102294975) has the molecular formula C26H28O4 and a molecular weight of 404.51 g/mol. Its IUPAC name is (E)-1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 102294975 |
| Molecular Formula | C26H28O4 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (E)-1-[(1R,5S)-10-hydroxy-1,6,6-trimethyl-7,16-dioxatetracyclo[10.3.1.05,14.08,13]hexadeca-8,10,12-trien-9-yl]-3-phenylprop-2-en-1-one |
| SMILES | CC1(C)Oc2c(C(=O)/C=C/c3ccccc3)c(O)cc3c2C2C[C@@](C)(CCC[C@@H]21)O3 |
| InChI | InChI=1S/C26H28O4/c1-25(2)18-10-7-13-26(3)15-17(18)22-21(29-26)14-20(28)23(24(22)30-25)19(27)12-11-16-8-5-4-6-9-16/h4-6,8-9,11-12,14,17-18,28H,7,10,13,15H2,1-3H3/b12-11+/t17?,18-,26+/m0/s1 |
| InChIKey | NEHQDCLGZLPXBX-QHGOOSBISA-N |
| XLogP | 5.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|