C35H44O4 — CID 74819238
3-phenyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)phenyl]prop-2-en-1-one (PubChem CID 74819238) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is 3-phenyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 3-phenyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 74819238 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 3-phenyl-1-[2,4,6-trihydroxy-3,5-bis(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)phenyl]prop-2-en-1-one |
| SMILES | CC1=CC(c2c(O)c(C(=O)C=Cc3ccccc3)c(O)c(C3C=C(C)CCC3C(C)C)c2O)C(C(C)C)CC1 |
| InChI | InChI=1S/C35H44O4/c1-20(2)25-15-12-22(5)18-27(25)30-33(37)31(28-19-23(6)13-16-26(28)21(3)4)35(39)32(34(30)38)29(36)17-14-24-10-8-7-9-11-24/h7-11,14,17-21,25-28,37-39H,12-13,15-16H2,1-6H3 |
| InChIKey | KYUKCFVAGXOEPH-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|