C26H30O4 — CID 102431468
5-hydroxy-7-methoxy-6-[(1R,6R)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 102431468) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is 5-hydroxy-7-methoxy-6-[(1R,6R)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 5-hydroxy-7-methoxy-6-[(1R,6R)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 102431468 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 5-hydroxy-7-methoxy-6-[(1R,6R)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(c(O)c1[C@H]1C=C(C)CC[C@@H]1C(C)C)C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C26H30O4/c1-15(2)18-11-10-16(3)12-19(18)24-22(29-4)14-23-25(26(24)28)20(27)13-21(30-23)17-8-6-5-7-9-17/h5-9,12,14-15,18-19,21,28H,10-11,13H2,1-4H3/t18-,19+,21?/m1/s1 |
| InChIKey | FSLNGPMZDQWHEZ-QSJYAPKHSA-N |
| XLogP | 6.20 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|