C35H44O4 — CID 163032163
(2R)-5,7-dihydroxy-6,8-bis[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 163032163) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is (2R)-5,7-dihydroxy-6,8-bis[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-5,7-dihydroxy-6,8-bis[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163032163 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | (2R)-5,7-dihydroxy-6,8-bis[(1S,6S)-3-methyl-6-propan-2-ylcyclohex-2-en-1-yl]-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | CC1=C[C@@H](c2c(O)c3c(c([C@@H]4C=C(C)CC[C@H]4C(C)C)c2O)O[C@@H](c2ccccc2)CC3=O)[C@H](C(C)C)CC1 |
| InChI | InChI=1S/C35H44O4/c1-19(2)24-14-12-21(5)16-26(24)30-33(37)31(27-17-22(6)13-15-25(27)20(3)4)35-32(34(30)38)28(36)18-29(39-35)23-10-8-7-9-11-23/h7-11,16-17,19-20,24-27,29,37-38H,12-15,18H2,1-6H3/t24-,25-,26+,27+,29+/m0/s1 |
| InChIKey | CVKXAEQFTCAGJZ-SJBMPIJESA-N |
| XLogP | 9.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|