C33H32O7 — CID 73194135
5,7a-dihydroxy-6,8,8,10,10-pentamethyl-2,12-diphenyl-2,3,11a,12-tetrahydropyrano[2,3-a]xanthene-4,9,11-trione (PubChem CID 73194135) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is 5,7a-dihydroxy-6,8,8,10,10-pentamethyl-2,12-diphenyl-2,3,11a,12-tetrahydropyrano[2,3-a]xanthene-4,9,11-trione.
| Compound Name | 5,7a-dihydroxy-6,8,8,10,10-pentamethyl-2,12-diphenyl-2,3,11a,12-tetrahydropyrano[2,3-a]xanthene-4,9,11-trione |
|---|---|
| PubChem CID | 73194135 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 5,7a-dihydroxy-6,8,8,10,10-pentamethyl-2,12-diphenyl-2,3,11a,12-tetrahydropyrano[2,3-a]xanthene-4,9,11-trione |
| SMILES | Cc1c(O)c2c(c3c1OC1(O)C(C(=O)C(C)(C)C(=O)C1(C)C)C3c1ccccc1)OC(c1ccccc1)CC2=O |
| InChI | InChI=1S/C33H32O7/c1-17-26(35)23-20(34)16-21(18-12-8-6-9-13-18)39-28(23)24-22(19-14-10-7-11-15-19)25-29(36)31(2,3)30(37)32(4,5)33(25,38)40-27(17)24/h6-15,21-22,25,35,38H,16H2,1-5H3 |
| InChIKey | VAJKIKOYPOZJCO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|