C20H40O6Si2 — CID 101274075
(6aR,8R,9S,9aS)-2,2,4,4-tetra(propan-2-yl)-8-prop-2-enoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 101274075) has the molecular formula C20H40O6Si2 and a molecular weight of 432.71 g/mol. Its IUPAC name is (6aR,8R,9S,9aS)-2,2,4,4-tetra(propan-2-yl)-8-prop-2-enoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8R,9S,9aS)-2,2,4,4-tetra(propan-2-yl)-8-prop-2-enoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 101274075 |
| Molecular Formula | C20H40O6Si2 |
| Molecular Weight | 432.71 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (6aR,8R,9S,9aS)-2,2,4,4-tetra(propan-2-yl)-8-prop-2-enoxy-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | C=CCO[C@@H]1O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C20H40O6Si2/c1-10-11-22-20-18(21)19-17(24-20)12-23-27(13(2)3,14(4)5)26-28(25-19,15(6)7)16(8)9/h10,13-21H,1,11-12H2,2-9H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | CCDUOFBRQGKEFQ-IYWMVGAKSA-N |
| XLogP | 4.23 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.71 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|