C20H40NO3+ — CID 101276463
dibutyl-(1-carboxypropyl)-[(E)-2-hydroxyoct-4-enyl]azanium (PubChem CID 101276463) has the molecular formula C20H40NO3+ and a molecular weight of 342.54 g/mol. Its IUPAC name is dibutyl-(1-carboxypropyl)-[(E)-2-hydroxyoct-4-enyl]azanium.
| Compound Name | dibutyl-(1-carboxypropyl)-[(E)-2-hydroxyoct-4-enyl]azanium |
|---|---|
| PubChem CID | 101276463 |
| Molecular Formula | C20H40NO3+ |
| Molecular Weight | 342.54 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | dibutyl-(1-carboxypropyl)-[(E)-2-hydroxyoct-4-enyl]azanium |
| SMILES | CCC/C=C/CC(O)C[N+](CCCC)(CCCC)C(CC)C(=O)O |
| InChI | InChI=1S/C20H39NO3/c1-5-9-12-13-14-18(22)17-21(15-10-6-2,16-11-7-3)19(8-4)20(23)24/h12-13,18-19,22H,5-11,14-17H2,1-4H3/p+1/b13-12+ |
| InChIKey | SQXXRRWGDIEXSR-OUKQBFOZSA-O |
| XLogP | 4.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|