C21H40NO5+ — CID 101276044
1-carboxyethyl-(2-hydroxyethyl)-bis[(E)-2-hydroxyoct-5-enyl]azanium (PubChem CID 101276044) has the molecular formula C21H40NO5+ and a molecular weight of 386.55 g/mol. Its IUPAC name is 1-carboxyethyl-(2-hydroxyethyl)-bis[(E)-2-hydroxyoct-5-enyl]azanium.
| Compound Name | 1-carboxyethyl-(2-hydroxyethyl)-bis[(E)-2-hydroxyoct-5-enyl]azanium |
|---|---|
| PubChem CID | 101276044 |
| Molecular Formula | C21H40NO5+ |
| Molecular Weight | 386.55 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | 1-carboxyethyl-(2-hydroxyethyl)-bis[(E)-2-hydroxyoct-5-enyl]azanium |
| SMILES | CC/C=C/CCC(O)C[N+](CCO)(CC(O)CC/C=C/CC)C(C)C(=O)O |
| InChI | InChI=1S/C21H39NO5/c1-4-6-8-10-12-19(24)16-22(14-15-23,18(3)21(26)27)17-20(25)13-11-9-7-5-2/h6-9,18-20,23-25H,4-5,10-17H2,1-3H3/p+1/b8-6+,9-7+ |
| InChIKey | DUTOXABKMLKCOF-CDJQDVQCSA-O |
| XLogP | 2.48 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|