C19H38NO3+ — CID 101276759
dibutyl-(1-carboxyethyl)-[(E)-2-hydroxyoct-4-enyl]azanium (PubChem CID 101276759) has the molecular formula C19H38NO3+ and a molecular weight of 328.52 g/mol. Its IUPAC name is dibutyl-(1-carboxyethyl)-[(E)-2-hydroxyoct-4-enyl]azanium.
| Compound Name | dibutyl-(1-carboxyethyl)-[(E)-2-hydroxyoct-4-enyl]azanium |
|---|---|
| PubChem CID | 101276759 |
| Molecular Formula | C19H38NO3+ |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.28 |
| IUPAC Name | dibutyl-(1-carboxyethyl)-[(E)-2-hydroxyoct-4-enyl]azanium |
| SMILES | CCC/C=C/CC(O)C[N+](CCCC)(CCCC)C(C)C(=O)O |
| InChI | InChI=1S/C19H37NO3/c1-5-8-11-12-13-18(21)16-20(14-9-6-2,15-10-7-3)17(4)19(22)23/h11-12,17-18,21H,5-10,13-16H2,1-4H3/p+1/b12-11+ |
| InChIKey | NNNFDZPFWMRBKD-VAWYXSNFSA-O |
| XLogP | 3.98 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|