C14H20 — CID 101280147
(E)-5,6-diethyldec-5-en-3,7-diyne (PubChem CID 101280147) has the molecular formula C14H20 and a molecular weight of 188.31 g/mol. Its IUPAC name is (E)-5,6-diethyldec-5-en-3,7-diyne.
| Compound Name | (E)-5,6-diethyldec-5-en-3,7-diyne |
|---|---|
| PubChem CID | 101280147 |
| Molecular Formula | C14H20 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | (E)-5,6-diethyldec-5-en-3,7-diyne |
| SMILES | CCC#C/C(CC)=C(/C#CCC)CC |
| InChI | InChI=1S/C14H20/c1-5-9-11-13(7-3)14(8-4)12-10-6-2/h5-8H2,1-4H3/b14-13+ |
| InChIKey | RHLPBAPBYVYDQF-BUHFOSPRSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|