C30H52N2O3 — CID 101280258
N-[(3S,6S,7R,8S,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-3-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-enyl]-2-methylpropanamide (PubChem CID 101280258) has the molecular formula C30H52N2O3 and a molecular weight of 488.76 g/mol. Its IUPAC name is N-[(3S,6S,7R,8S,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-3-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-enyl]-2-methylpropanamide.
| Compound Name | N-[(3S,6S,7R,8S,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-3-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-enyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 101280258 |
| Molecular Formula | C30H52N2O3 |
| Molecular Weight | 488.76 g/mol |
| Exact Mass | 488.40 |
| IUPAC Name | N-[(3S,6S,7R,8S,11R,12S,15S,16R)-15-[(1S)-1-(dimethylamino)ethyl]-3-hydroxy-7-(hydroxymethyl)-7,12,16-trimethyl-6-tetracyclo[9.7.0.03,8.012,16]octadec-1(18)-enyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)N[C@H]1CC[C@]2(O)CC3=CC[C@]4(C)[C@@H]([C@H](C)N(C)C)CC[C@@]4(C)[C@@H]3CC[C@H]2[C@@]1(C)CO |
| InChI | InChI=1S/C30H52N2O3/c1-19(2)26(34)31-25-13-16-30(35)17-21-11-14-28(5)22(20(3)32(7)8)12-15-29(28,6)23(21)9-10-24(30)27(25,4)18-33/h11,19-20,22-25,33,35H,9-10,12-18H2,1-8H3,(H,31,34)/t20-,22+,23+,24-,25-,27+,28+,29-,30-/m0/s1 |
| InChIKey | HQOMDWQLBMUSLP-USEDVGOVSA-N |
| XLogP | 4.77 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.76 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|