C30H50Cl2OSi — CID 101281712
[(1S)-3-[(E)-2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-yl]oxy-(dichloromethyl)-dimethylsilane (PubChem CID 101281712) has the molecular formula C30H50Cl2OSi and a molecular weight of 525.72 g/mol. Its IUPAC name is [(1S)-3-[(E)-2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-yl]oxy-(dichloromethyl)-dimethylsilane.
| Compound Name | [(1S)-3-[(E)-2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-yl]oxy-(dichloromethyl)-dimethylsilane |
|---|---|
| PubChem CID | 101281712 |
| Molecular Formula | C30H50Cl2OSi |
| Molecular Weight | 525.72 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [(1S)-3-[(E)-2-[(1R,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,5,6,7-hexahydroinden-4-yl]ethenyl]-4-methylcyclohex-3-en-1-yl]oxy-(dichloromethyl)-dimethylsilane |
| SMILES | CC1=C(/C=C/C2=C3CC[C@H]([C@H](C)CCCC(C)C)[C@@]3(C)CCC2)C[C@@H](O[Si](C)(C)C(Cl)Cl)CC1 |
| InChI | InChI=1S/C30H50Cl2OSi/c1-21(2)10-8-11-23(4)27-17-18-28-24(12-9-19-30(27,28)5)14-15-25-20-26(16-13-22(25)3)33-34(6,7)29(31)32/h14-15,21,23,26-27,29H,8-13,16-20H2,1-7H3/b15-14+/t23-,26+,27-,30-/m1/s1 |
| InChIKey | JEYJITOEWCIOAG-BAHRVELLSA-N |
| XLogP | 10.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.72 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|