About 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile
3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile (PubChem CID 101282891) has the molecular formula C13H25N5
and a molecular weight of 251.38 g/mol. Its IUPAC name is 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile |
| PubChem CID | 101282891 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile |
| SMILES | CC(CCN(CCC#N)CCC#N)C(N)CCN |
| InChI | InChI=1S/C13H25N5/c1-12(13(17)4-8-16)5-11-18(9-2-6-14)10-3-7-15/h12-13H,2-5,8-11,16-17H2,1H3 |
| InChIKey | IGNIFQZVPDGVQE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 102.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile?
The IUPAC name of 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile (CID 101282891) is 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile.
What is the SMILES notation for 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile?
The canonical SMILES for 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile is CC(CCN(CCC#N)CCC#N)C(N)CCN.
What is the InChIKey of 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile?
The InChIKey is IGNIFQZVPDGVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N5/c1-12(13(17)4-8-16)5-11-18(9-2-6-14)10-3-7-15/h12-13H,2-5,8-11,16-17H2,1H3.
What are the key properties of 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile?
3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile has a molecular weight of 251.38 g/mol, XLogP of 0.82, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-cyanoethyl-(4,6-diamino-3-methylhexyl)amino]propanenitrile is sourced from PubChem (CID 101282891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).