C22H42CaN4O6 — CID 101284211
calcium bis(3-[2-[[(E)-2-hydroxyhex-4-enyl]amino]ethylamino]propanoate) (PubChem CID 101284211) has the molecular formula C22H42CaN4O6 and a molecular weight of 498.68 g/mol. Its IUPAC name is calcium bis(3-[2-[[(E)-2-hydroxyhex-4-enyl]amino]ethylamino]propanoate).
| Compound Name | calcium bis(3-[2-[[(E)-2-hydroxyhex-4-enyl]amino]ethylamino]propanoate) |
|---|---|
| PubChem CID | 101284211 |
| Molecular Formula | C22H42CaN4O6 |
| Molecular Weight | 498.68 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | calcium bis(3-[2-[[(E)-2-hydroxyhex-4-enyl]amino]ethylamino]propanoate) |
| SMILES | C/C=C/CC(O)CNCCNCCC(=O)[O-].C/C=C/CC(O)CNCCNCCC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C11H22N2O3.Ca/c2*1-2-3-4-10(14)9-13-8-7-12-6-5-11(15)16;/h2*2-3,10,12-14H,4-9H2,1H3,(H,15,16);/q;;+2/p-2/b2*3-2+; |
| InChIKey | OYBLEGSJCZSDSW-SFRQHTGFSA-L |
| XLogP | -3.12 |
| TPSA | 168.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.68 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|