C12H23KN2O3 — CID 101284266
potassium 3-[2-[[(E)-2-hydroxyhept-4-enyl]amino]ethylamino]propanoate (PubChem CID 101284266) has the molecular formula C12H23KN2O3 and a molecular weight of 282.42 g/mol. Its IUPAC name is potassium 3-[2-[[(E)-2-hydroxyhept-4-enyl]amino]ethylamino]propanoate.
| Compound Name | potassium 3-[2-[[(E)-2-hydroxyhept-4-enyl]amino]ethylamino]propanoate |
|---|---|
| PubChem CID | 101284266 |
| Molecular Formula | C12H23KN2O3 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | potassium 3-[2-[[(E)-2-hydroxyhept-4-enyl]amino]ethylamino]propanoate |
| SMILES | CC/C=C/CC(O)CNCCNCCC(=O)[O-].[K+] |
| InChI | InChI=1S/C12H24N2O3.K/c1-2-3-4-5-11(15)10-14-9-8-13-7-6-12(16)17;/h3-4,11,13-15H,2,5-10H2,1H3,(H,16,17);/q;+1/p-1/b4-3+; |
| InChIKey | FINPUTOLFJHLFR-BJILWQEISA-M |
| XLogP | -3.97 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | -3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|