C32H29Cl2NO — CID 10128471
[3,4-bis(4-chlorophenyl)phenyl]-(4-ethyl-4-phenylpiperidin-1-yl)methanone (PubChem CID 10128471) has the molecular formula C32H29Cl2NO and a molecular weight of 514.50 g/mol. Its IUPAC name is [3,4-bis(4-chlorophenyl)phenyl]-(4-ethyl-4-phenylpiperidin-1-yl)methanone.
| Compound Name | [3,4-bis(4-chlorophenyl)phenyl]-(4-ethyl-4-phenylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 10128471 |
| Molecular Formula | C32H29Cl2NO |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [3,4-bis(4-chlorophenyl)phenyl]-(4-ethyl-4-phenylpiperidin-1-yl)methanone |
| SMILES | CCC1(c2ccccc2)CCN(C(=O)c2ccc(-c3ccc(Cl)cc3)c(-c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C32H29Cl2NO/c1-2-32(26-6-4-3-5-7-26)18-20-35(21-19-32)31(36)25-12-17-29(23-8-13-27(33)14-9-23)30(22-25)24-10-15-28(34)16-11-24/h3-17,22H,2,18-21H2,1H3 |
| InChIKey | VLOZTALFTJUQJF-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |