C31H49NO5 — CID 10128495
[(9S,13R)-6-(4-acetamido-3-methylbutyl)-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl] acetate (PubChem CID 10128495) has the molecular formula C31H49NO5 and a molecular weight of 515.74 g/mol. Its IUPAC name is [(9S,13R)-6-(4-acetamido-3-methylbutyl)-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl] acetate.
| Compound Name | [(9S,13R)-6-(4-acetamido-3-methylbutyl)-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl] acetate |
|---|---|
| PubChem CID | 10128495 |
| Molecular Formula | C31H49NO5 |
| Molecular Weight | 515.74 g/mol |
| Exact Mass | 515.36 |
| IUPAC Name | [(9S,13R)-6-(4-acetamido-3-methylbutyl)-6-hydroxy-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-16-yl] acetate |
| SMILES | CC(=O)NCC(C)CCC1(O)OC2CC3C4CC=C5CC(OC(C)=O)CC[C@]5(C)C4CC[C@]3(C)C2C1C |
| InChI | InChI=1S/C31H49NO5/c1-18(17-32-20(3)33)9-14-31(35)19(2)28-27(37-31)16-26-24-8-7-22-15-23(36-21(4)34)10-12-29(22,5)25(24)11-13-30(26,28)6/h7,18-19,23-28,35H,8-17H2,1-6H3,(H,32,33)/t18?,19?,23?,24?,25?,26?,27?,28?,29-,30-,31?/m0/s1 |
| InChIKey | VNMXCTJDIFCQPS-WZRMKTSFSA-N |
| XLogP | 5.38 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|