C29H44N2O4 — CID 125113980
[(1R,2S,4S,5'S,6R,7R,8S,9S,12R,13R,16R)-5',7,9,13-tetramethyl-1'-nitrosospiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] acetate (PubChem CID 125113980) has the molecular formula C29H44N2O4 and a molecular weight of 484.68 g/mol. Its IUPAC name is [(1R,2S,4S,5'S,6R,7R,8S,9S,12R,13R,16R)-5',7,9,13-tetramethyl-1'-nitrosospiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] acetate.
| Compound Name | [(1R,2S,4S,5'S,6R,7R,8S,9S,12R,13R,16R)-5',7,9,13-tetramethyl-1'-nitrosospiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] acetate |
|---|---|
| PubChem CID | 125113980 |
| Molecular Formula | C29H44N2O4 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | [(1R,2S,4S,5'S,6R,7R,8S,9S,12R,13R,16R)-5',7,9,13-tetramethyl-1'-nitrosospiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-ene-6,2'-piperidine]-16-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(=CC[C@H]3[C@H]2CC[C@]2(C)[C@H]4[C@H](C[C@@H]32)O[C@]2(CC[C@H](C)CN2N=O)[C@@H]4C)C1 |
| InChI | InChI=1S/C29H44N2O4/c1-17-8-13-29(31(16-17)30-33)18(2)26-25(35-29)15-24-22-7-6-20-14-21(34-19(3)32)9-11-27(20,4)23(22)10-12-28(24,26)5/h6,17-18,21-26H,7-16H2,1-5H3/t17-,18+,21+,22-,23+,24-,25-,26+,27-,28-,29+/m0/s1 |
| InChIKey | VLWWKLYGUPZSCU-VOFXHMIJSA-N |
| XLogP | 6.25 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|