C32H50N2O4 — CID 22214065
[(1S,2S,4S,8S,9S,12S,13R)-6-[4-(dimethylcarbamoylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate (PubChem CID 22214065) has the molecular formula C32H50N2O4 and a molecular weight of 526.76 g/mol. Its IUPAC name is [(1S,2S,4S,8S,9S,12S,13R)-6-[4-(dimethylcarbamoylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate.
| Compound Name | [(1S,2S,4S,8S,9S,12S,13R)-6-[4-(dimethylcarbamoylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
|---|---|
| PubChem CID | 22214065 |
| Molecular Formula | C32H50N2O4 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.38 |
| IUPAC Name | [(1S,2S,4S,8S,9S,12S,13R)-6-[4-(dimethylcarbamoylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
| SMILES | CC(=O)OC1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@@H]5OC(CCC(C)CNC(=O)N(C)C)=C(C)[C@@H]5[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H50N2O4/c1-19(18-33-30(36)34(6)7)8-11-27-20(2)29-28(38-27)17-26-24-10-9-22-16-23(37-21(3)35)12-14-31(22,4)25(24)13-15-32(26,29)5/h9,19,23-26,28-29H,8,10-18H2,1-7H3,(H,33,36)/t19?,23?,24-,25+,26+,28+,29+,31+,32+/m1/s1 |
| InChIKey | DJBVJIHRRDTQPO-PIFISACISA-N |
| XLogP | 6.47 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|