C29H43N3O3 — CID 53497300
[(1S,2S,4S,8S,9S,12S,13R,16S)-6-[(3R)-4-azido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate (PubChem CID 53497300) has the molecular formula C29H43N3O3 and a molecular weight of 481.68 g/mol. Its IUPAC name is [(1S,2S,4S,8S,9S,12S,13R,16S)-6-[(3R)-4-azido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate.
| Compound Name | [(1S,2S,4S,8S,9S,12S,13R,16S)-6-[(3R)-4-azido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
|---|---|
| PubChem CID | 53497300 |
| Molecular Formula | C29H43N3O3 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.33 |
| IUPAC Name | [(1S,2S,4S,8S,9S,12S,13R,16S)-6-[(3R)-4-azido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4C[C@@H]5OC(CC[C@@H](C)CN=[N+]=[N-])=C(C)[C@@H]5[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H43N3O3/c1-17(16-31-32-30)6-9-25-18(2)27-26(35-25)15-24-22-8-7-20-14-21(34-19(3)33)10-12-28(20,4)23(22)11-13-29(24,27)5/h7,17,21-24,26-27H,6,8-16H2,1-5H3/t17-,21+,22-,23+,24+,26+,27+,28+,29+/m1/s1 |
| InChIKey | LTBLJLHWQIXHAR-JEBZPVOZSA-N |
| XLogP | 7.51 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|