C33H49NO5 — CID 51443402
[(1R,2S,4R,8S,9S,12R,13R,16S)-6-[(3R)-4-(diacetylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate (PubChem CID 51443402) has the molecular formula C33H49NO5 and a molecular weight of 539.76 g/mol. Its IUPAC name is [(1R,2S,4R,8S,9S,12R,13R,16S)-6-[(3R)-4-(diacetylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate.
| Compound Name | [(1R,2S,4R,8S,9S,12R,13R,16S)-6-[(3R)-4-(diacetylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
|---|---|
| PubChem CID | 51443402 |
| Molecular Formula | C33H49NO5 |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.36 |
| IUPAC Name | [(1R,2S,4R,8S,9S,12R,13R,16S)-6-[(3R)-4-(diacetylamino)-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@H]2CC[C@@]2(C)[C@H]3C[C@H]3OC(CC[C@@H](C)CN(C(C)=O)C(C)=O)=C(C)[C@@H]32)C1 |
| InChI | InChI=1S/C33H49NO5/c1-19(18-34(21(3)35)22(4)36)8-11-29-20(2)31-30(39-29)17-28-26-10-9-24-16-25(38-23(5)37)12-14-32(24,6)27(26)13-15-33(28,31)7/h9,19,25-28,30-31H,8,10-18H2,1-7H3/t19-,25+,26+,27-,28+,30-,31+,32+,33+/m1/s1 |
| InChIKey | WURLGASLEZVNHV-YQUINIIPSA-N |
| XLogP | 6.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|