C35H55NO4 — CID 25426066
[(1S,2S,4S,8S,9S,12S,13R,16R)-6-[(3R)-4-acetamido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] 4-methylpentanoate (PubChem CID 25426066) has the molecular formula C35H55NO4 and a molecular weight of 553.83 g/mol. Its IUPAC name is [(1S,2S,4S,8S,9S,12S,13R,16R)-6-[(3R)-4-acetamido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] 4-methylpentanoate.
| Compound Name | [(1S,2S,4S,8S,9S,12S,13R,16R)-6-[(3R)-4-acetamido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] 4-methylpentanoate |
|---|---|
| PubChem CID | 25426066 |
| Molecular Formula | C35H55NO4 |
| Molecular Weight | 553.83 g/mol |
| Exact Mass | 553.41 |
| IUPAC Name | [(1S,2S,4S,8S,9S,12S,13R,16R)-6-[(3R)-4-acetamido-3-methylbutyl]-7,9,13-trimethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl] 4-methylpentanoate |
| SMILES | CC(=O)NC[C@H](C)CCC1=C(C)[C@H]2[C@H](C[C@H]3[C@@H]4CC=C5C[C@H](OC(=O)CCC(C)C)CC[C@]5(C)[C@H]4CC[C@@]32C)O1 |
| InChI | InChI=1S/C35H55NO4/c1-21(2)8-13-32(38)39-26-14-16-34(6)25(18-26)10-11-27-28(34)15-17-35(7)29(27)19-31-33(35)23(4)30(40-31)12-9-22(3)20-36-24(5)37/h10,21-22,26-29,31,33H,8-9,11-20H2,1-7H3,(H,36,37)/t22-,26-,27-,28+,29+,31+,33+,34+,35+/m1/s1 |
| InChIKey | ZBSYSDJYMWIJFZ-WSCFNAAYSA-N |
| XLogP | 7.75 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.83 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|