C33H64NO3S+ — CID 101285581
tris[(E)-dec-1-enyl]-(3-sulfopropyl)azanium (PubChem CID 101285581) has the molecular formula C33H64NO3S+ and a molecular weight of 554.95 g/mol. Its IUPAC name is tris[(E)-dec-1-enyl]-(3-sulfopropyl)azanium.
| Compound Name | tris[(E)-dec-1-enyl]-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 101285581 |
| Molecular Formula | C33H64NO3S+ |
| Molecular Weight | 554.95 g/mol |
| Exact Mass | 554.46 |
| IUPAC Name | tris[(E)-dec-1-enyl]-(3-sulfopropyl)azanium |
| SMILES | CCCCCCCC/C=C/[N+](/C=C/CCCCCCCC)(/C=C/CCCCCCCC)CCCS(=O)(=O)O |
| InChI | InChI=1S/C33H63NO3S/c1-4-7-10-13-16-19-22-25-29-34(32-28-33-38(35,36)37,30-26-23-20-17-14-11-8-5-2)31-27-24-21-18-15-12-9-6-3/h25-27,29-31H,4-24,28,32-33H2,1-3H3/p+1/b29-25+,30-26+,31-27+ |
| InChIKey | PNNIAXCPPYCFMM-AGOMCYSNSA-O |
| XLogP | 10.87 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.95 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|