C8H5Cl5 — CID 101286849
1,3-dichloro-4-methyl-2-(trichloromethyl)benzene (PubChem CID 101286849) has the molecular formula C8H5Cl5 and a molecular weight of 278.39 g/mol. Its IUPAC name is 1,3-dichloro-4-methyl-2-(trichloromethyl)benzene.
| Compound Name | 1,3-dichloro-4-methyl-2-(trichloromethyl)benzene |
|---|---|
| PubChem CID | 101286849 |
| Molecular Formula | C8H5Cl5 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 275.88 |
| IUPAC Name | 1,3-dichloro-4-methyl-2-(trichloromethyl)benzene |
| SMILES | Cc1ccc(Cl)c(C(Cl)(Cl)Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl5/c1-4-2-3-5(9)6(7(4)10)8(11,12)13/h2-3H,1H3 |
| InChIKey | PTDGJQWTWHZWFC-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|