C8H9Cl3Si — CID 151842892
chloro-(2,3-dichloro-6-methylphenyl)-methylsilane (PubChem CID 151842892) has the molecular formula C8H9Cl3Si and a molecular weight of 239.60 g/mol. Its IUPAC name is chloro-(2,3-dichloro-6-methylphenyl)-methylsilane.
| Compound Name | chloro-(2,3-dichloro-6-methylphenyl)-methylsilane |
|---|---|
| PubChem CID | 151842892 |
| Molecular Formula | C8H9Cl3Si |
| Molecular Weight | 239.60 g/mol |
| Exact Mass | 237.95 |
| IUPAC Name | chloro-(2,3-dichloro-6-methylphenyl)-methylsilane |
| SMILES | Cc1ccc(Cl)c(Cl)c1[SiH](C)Cl |
| InChI | InChI=1S/C8H9Cl3Si/c1-5-3-4-6(9)7(10)8(5)12(2)11/h3-4,12H,1-2H3 |
| InChIKey | SHAUDEPFKBUFLP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|