About [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate
[2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate (PubChem CID 101287127) has the molecular formula C21H40O7
and a molecular weight of 404.54 g/mol. Its IUPAC name is [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate.
Molecular Properties
| Compound Name | [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate |
| PubChem CID | 101287127 |
| Molecular Formula | C21H40O7 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate |
| SMILES | CCCCCCC(O)C(=O)OCC(C)(CO)COC(=O)C(O)CCCCCC |
| InChI | InChI=1S/C21H40O7/c1-4-6-8-10-12-17(23)19(25)27-15-21(3,14-22)16-28-20(26)18(24)13-11-9-7-5-2/h17-18,22-24H,4-16H2,1-3H3 |
| InChIKey | KCGTVUYGYHKVRJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate?
The IUPAC name of [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate (CID 101287127) is [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate.
What is the SMILES notation for [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate?
The canonical SMILES for [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate is CCCCCCC(O)C(=O)OCC(C)(CO)COC(=O)C(O)CCCCCC.
What is the InChIKey of [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate?
The InChIKey is KCGTVUYGYHKVRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H40O7/c1-4-6-8-10-12-17(23)19(25)27-15-21(3,14-22)16-28-20(26)18(24)13-11-9-7-5-2/h17-18,22-24H,4-16H2,1-3H3.
What are the key properties of [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate?
[2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate has a molecular weight of 404.54 g/mol, XLogP of 2.73, 17 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(hydroxymethyl)-3-(2-hydroxyoctanoyloxy)-2-methylpropyl] 2-hydroxyoctanoate is sourced from PubChem (CID 101287127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).