C22H28N2O3 — CID 101288245
[(12S,14S,15Z,18R,19R)-15-ethylidene-18-methoxy-11-methyl-17-oxa-1,11-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20)-tetraen-19-yl]methanol (PubChem CID 101288245) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is [(12S,14S,15Z,18R,19R)-15-ethylidene-18-methoxy-11-methyl-17-oxa-1,11-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20)-tetraen-19-yl]methanol.
| Compound Name | [(12S,14S,15Z,18R,19R)-15-ethylidene-18-methoxy-11-methyl-17-oxa-1,11-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20)-tetraen-19-yl]methanol |
|---|---|
| PubChem CID | 101288245 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | [(12S,14S,15Z,18R,19R)-15-ethylidene-18-methoxy-11-methyl-17-oxa-1,11-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2,4,6,8(20)-tetraen-19-yl]methanol |
| SMILES | C/C=C1\CO[C@@H](OC)[C@]2(CO)[C@H]1C[C@H]1c3c(c4ccccc4n32)CCN1C |
| InChI | InChI=1S/C22H28N2O3/c1-4-14-12-27-21(26-3)22(13-25)17(14)11-19-20-16(9-10-23(19)2)15-7-5-6-8-18(15)24(20)22/h4-8,17,19,21,25H,9-13H2,1-3H3/b14-4+/t17-,19-,21+,22-/m0/s1 |
| InChIKey | LOZYRTSBXQDHEG-VIOHEDNDSA-N |
| XLogP | 2.83 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|