(1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate

C10H12O3 — CID 101289896

IUPAC(1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate
SMILESCC(=O)OC1(C)C=C(C)C=CC1=O
InChIInChI=1S/C10H12O3/c1-7-4-5-9(12)10(3,6-7)13-8(2)11/h4-6H,1-3H3
InChIKeyPPWCHXGMDZVEST-UHFFFAOYSA-N
MW180.20 g/mol
LogP1.39
Rot. Bonds1

About (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate

(1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 101289896) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.

Molecular Properties

Compound Name(1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate
PubChem CID101289896
Molecular FormulaC10H12O3
Molecular Weight180.20 g/mol
Exact Mass180.08
IUPAC Name(1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate
SMILESCC(=O)OC1(C)C=C(C)C=CC1=O
InChIInChI=1S/C10H12O3/c1-7-4-5-9(12)10(3,6-7)13-8(2)11/h4-6H,1-3H3
InChIKeyPPWCHXGMDZVEST-UHFFFAOYSA-N
XLogP1.39
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.20
LogP ≤ 51.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (CID 101289896) is (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is CC(=O)OC1(C)C=C(C)C=CC1=O.
What is the InChIKey of (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is PPWCHXGMDZVEST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-4-5-9(12)10(3,6-7)13-8(2)11/h4-6H,1-3H3.
What are the key properties of (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
(1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 180.20 g/mol, XLogP of 1.39, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 101289896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).