C30H58CaO8S2 — CID 101290263
calcium bis(2-[(E)-hex-1-enyl]nonyl sulfate) (PubChem CID 101290263) has the molecular formula C30H58CaO8S2 and a molecular weight of 651.00 g/mol. Its IUPAC name is calcium bis(2-[(E)-hex-1-enyl]nonyl sulfate).
| Compound Name | calcium bis(2-[(E)-hex-1-enyl]nonyl sulfate) |
|---|---|
| PubChem CID | 101290263 |
| Molecular Formula | C30H58CaO8S2 |
| Molecular Weight | 651.00 g/mol |
| Exact Mass | 650.32 |
| IUPAC Name | calcium bis(2-[(E)-hex-1-enyl]nonyl sulfate) |
| SMILES | CCCC/C=C/C(CCCCCCC)COS(=O)(=O)[O-].CCCC/C=C/C(CCCCCCC)COS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C15H30O4S.Ca/c2*1-3-5-7-9-11-13-15(12-10-8-6-4-2)14-19-20(16,17)18;/h2*10,12,15H,3-9,11,13-14H2,1-2H3,(H,16,17,18);/q;;+2/p-2/b2*12-10+; |
| InChIKey | SJABLQYQEIICEB-KRYVHOLJSA-L |
| XLogP | 7.99 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.00 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|