C34H66CaO8S2 — CID 101290271
calcium bis(2-[(E)-hex-1-enyl]undecyl sulfate) (PubChem CID 101290271) has the molecular formula C34H66CaO8S2 and a molecular weight of 707.11 g/mol. Its IUPAC name is calcium bis(2-[(E)-hex-1-enyl]undecyl sulfate).
| Compound Name | calcium bis(2-[(E)-hex-1-enyl]undecyl sulfate) |
|---|---|
| PubChem CID | 101290271 |
| Molecular Formula | C34H66CaO8S2 |
| Molecular Weight | 707.11 g/mol |
| Exact Mass | 706.38 |
| IUPAC Name | calcium bis(2-[(E)-hex-1-enyl]undecyl sulfate) |
| SMILES | CCCC/C=C/C(CCCCCCCCC)COS(=O)(=O)[O-].CCCC/C=C/C(CCCCCCCCC)COS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C17H34O4S.Ca/c2*1-3-5-7-9-10-11-13-15-17(14-12-8-6-4-2)16-21-22(18,19)20;/h2*12,14,17H,3-11,13,15-16H2,1-2H3,(H,18,19,20);/q;;+2/p-2/b2*14-12+; |
| InChIKey | WEBMVSKUBWMRCN-MRFGFUSTSA-L |
| XLogP | 9.55 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.11 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|