About barium(2+);bis(3-octylphenolate)
barium(2+);bis(3-octylphenolate) (PubChem CID 101292599) has the molecular formula C28H42BaO2
and a molecular weight of 547.97 g/mol. Its IUPAC name is barium(2+);bis(3-octylphenolate).
Molecular Properties
| Compound Name | barium(2+);bis(3-octylphenolate) |
| PubChem CID | 101292599 |
| Molecular Formula | C28H42BaO2 |
| Molecular Weight | 547.97 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | barium(2+);bis(3-octylphenolate) |
| SMILES | CCCCCCCCc1cccc([O-])c1.CCCCCCCCc1cccc([O-])c1.[Ba+2] |
| InChI | InChI=1S/2C14H22O.Ba/c2*1-2-3-4-5-6-7-9-13-10-8-11-14(15)12-13;/h2*8,10-12,15H,2-7,9H2,1H3;/q;;+2/p-2 |
| InChIKey | KMYNTAABCBTXIN-UHFFFAOYSA-L |
| XLogP | 6.95 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 547.97 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(3-octylphenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(3-octylphenolate)?
The IUPAC name of barium(2+);bis(3-octylphenolate) (CID 101292599) is barium(2+);bis(3-octylphenolate).
What is the SMILES notation for barium(2+);bis(3-octylphenolate)?
The canonical SMILES for barium(2+);bis(3-octylphenolate) is CCCCCCCCc1cccc([O-])c1.CCCCCCCCc1cccc([O-])c1.[Ba+2].
What is the InChIKey of barium(2+);bis(3-octylphenolate)?
The InChIKey is KMYNTAABCBTXIN-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H22O.Ba/c2*1-2-3-4-5-6-7-9-13-10-8-11-14(15)12-13;/h2*8,10-12,15H,2-7,9H2,1H3;/q;;+2/p-2.
What are the key properties of barium(2+);bis(3-octylphenolate)?
barium(2+);bis(3-octylphenolate) has a molecular weight of 547.97 g/mol, XLogP of 6.95, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(3-octylphenolate) is sourced from PubChem (CID 101292599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).